C6H11N5 — CID 105230523
1-(1H-1,2,4-triazol-5-yl)but-3-enylhydrazine (PubChem CID 105230523) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)but-3-enylhydrazine.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)but-3-enylhydrazine |
|---|---|
| PubChem CID | 105230523 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)but-3-enylhydrazine |
| SMILES | C=CCC(NN)c1ncn[nH]1 |
| InChI | InChI=1S/C6H11N5/c1-2-3-5(10-7)6-8-4-9-11-6/h2,4-5,10H,1,3,7H2,(H,8,9,11) |
| InChIKey | WMZGTGVBXPIZGS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|