C11H12F3N5O — CID 105230325
[1-(1H-1,2,4-triazol-5-yl)-2-[4-(trifluoromethoxy)phenyl]ethyl]hydrazine (PubChem CID 105230325) has the molecular formula C11H12F3N5O and a molecular weight of 287.25 g/mol. Its IUPAC name is [1-(1H-1,2,4-triazol-5-yl)-2-[4-(trifluoromethoxy)phenyl]ethyl]hydrazine.
| Compound Name | [1-(1H-1,2,4-triazol-5-yl)-2-[4-(trifluoromethoxy)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 105230325 |
| Molecular Formula | C11H12F3N5O |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [1-(1H-1,2,4-triazol-5-yl)-2-[4-(trifluoromethoxy)phenyl]ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(OC(F)(F)F)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12F3N5O/c12-11(13,14)20-8-3-1-7(2-4-8)5-9(18-15)10-16-6-17-19-10/h1-4,6,9,18H,5,15H2,(H,16,17,19) |
| InChIKey | YUYVWGBATYOLMQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|