C11H10F3N3O4S — CID 126651282
[1H-1,2,4-triazol-5-yl-[4-(trifluoromethoxy)phenyl]methyl] methanesulfonate (PubChem CID 126651282) has the molecular formula C11H10F3N3O4S and a molecular weight of 337.28 g/mol. Its IUPAC name is [1H-1,2,4-triazol-5-yl-[4-(trifluoromethoxy)phenyl]methyl] methanesulfonate.
| Compound Name | [1H-1,2,4-triazol-5-yl-[4-(trifluoromethoxy)phenyl]methyl] methanesulfonate |
|---|---|
| PubChem CID | 126651282 |
| Molecular Formula | C11H10F3N3O4S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | [1H-1,2,4-triazol-5-yl-[4-(trifluoromethoxy)phenyl]methyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(c1ccc(OC(F)(F)F)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H10F3N3O4S/c1-22(18,19)21-9(10-15-6-16-17-10)7-2-4-8(5-3-7)20-11(12,13)14/h2-6,9H,1H3,(H,15,16,17) |
| InChIKey | PGZDCWKLRYDYAQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|