C13H17F3O4S — CID 111435438
2-methyl-1-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]propan-2-ol (PubChem CID 111435438) has the molecular formula C13H17F3O4S and a molecular weight of 326.34 g/mol. Its IUPAC name is 2-methyl-1-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]propan-2-ol.
| Compound Name | 2-methyl-1-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]propan-2-ol |
|---|---|
| PubChem CID | 111435438 |
| Molecular Formula | C13H17F3O4S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-methyl-1-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]propan-2-ol |
| SMILES | CC(c1ccc(OC(F)(F)F)cc1)S(=O)(=O)CC(C)(C)O |
| InChI | InChI=1S/C13H17F3O4S/c1-9(21(18,19)8-12(2,3)17)10-4-6-11(7-5-10)20-13(14,15)16/h4-7,9,17H,8H2,1-3H3 |
| InChIKey | WPPRIWFBBRTEFR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |