C16H15F3O3S — CID 122600808
1-methyl-4-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzene (PubChem CID 122600808) has the molecular formula C16H15F3O3S and a molecular weight of 344.35 g/mol. Its IUPAC name is 1-methyl-4-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzene.
| Compound Name | 1-methyl-4-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzene |
|---|---|
| PubChem CID | 122600808 |
| Molecular Formula | C16H15F3O3S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-methyl-4-[1-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzene |
| SMILES | Cc1ccc(S(=O)(=O)C(C)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F3O3S/c1-11-3-9-15(10-4-11)23(20,21)12(2)13-5-7-14(8-6-13)22-16(17,18)19/h3-10,12H,1-2H3 |
| InChIKey | VIMPQBSPZMOFOV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |