C12H17F3N2O3S — CID 105290912
[4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butyl]hydrazine (PubChem CID 105290912) has the molecular formula C12H17F3N2O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is [4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butyl]hydrazine.
| Compound Name | [4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butyl]hydrazine |
|---|---|
| PubChem CID | 105290912 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butyl]hydrazine |
| SMILES | CS(=O)(=O)CCCC(NN)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H17F3N2O3S/c1-21(18,19)8-2-3-11(17-16)9-4-6-10(7-5-9)20-12(13,14)15/h4-7,11,17H,2-3,8,16H2,1H3 |
| InChIKey | LSUJPZQVOLOAGE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|