C9H13N7 — CID 105230663
3-[2-hydrazinyl-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine (PubChem CID 105230663) has the molecular formula C9H13N7 and a molecular weight of 219.25 g/mol. Its IUPAC name is 3-[2-hydrazinyl-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine.
| Compound Name | 3-[2-hydrazinyl-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 105230663 |
| Molecular Formula | C9H13N7 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 3-[2-hydrazinyl-2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine |
| SMILES | NNC(Cc1cnccc1N)c1ncn[nH]1 |
| InChI | InChI=1S/C9H13N7/c10-7-1-2-12-4-6(7)3-8(15-11)9-13-5-14-16-9/h1-2,4-5,8,15H,3,11H2,(H2,10,12)(H,13,14,16) |
| InChIKey | JOVMWLBLBHFYMZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|