C10H18N4 — CID 105199730
3-(2-hydrazinyl-3-methylbutyl)pyridin-4-amine (PubChem CID 105199730) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-(2-hydrazinyl-3-methylbutyl)pyridin-4-amine.
| Compound Name | 3-(2-hydrazinyl-3-methylbutyl)pyridin-4-amine |
|---|---|
| PubChem CID | 105199730 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 3-(2-hydrazinyl-3-methylbutyl)pyridin-4-amine |
| SMILES | CC(C)C(Cc1cnccc1N)NN |
| InChI | InChI=1S/C10H18N4/c1-7(2)10(14-12)5-8-6-13-4-3-9(8)11/h3-4,6-7,10,14H,5,12H2,1-2H3,(H2,11,13) |
| InChIKey | VNKPLWXIJYDGKV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|