C11H20N4O — CID 105270886
3-(2-hydrazinyl-3-methoxypentyl)pyridin-4-amine (PubChem CID 105270886) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-(2-hydrazinyl-3-methoxypentyl)pyridin-4-amine.
| Compound Name | 3-(2-hydrazinyl-3-methoxypentyl)pyridin-4-amine |
|---|---|
| PubChem CID | 105270886 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-(2-hydrazinyl-3-methoxypentyl)pyridin-4-amine |
| SMILES | CCC(OC)C(Cc1cnccc1N)NN |
| InChI | InChI=1S/C11H20N4O/c1-3-11(16-2)10(15-13)6-8-7-14-5-4-9(8)12/h4-5,7,10-11,15H,3,6,13H2,1-2H3,(H2,12,14) |
| InChIKey | BLARCFRUSIVYBU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|