C11H19N3S — CID 65129254
3-(2-amino-3-propylsulfanylpropyl)pyridin-4-amine (PubChem CID 65129254) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 3-(2-amino-3-propylsulfanylpropyl)pyridin-4-amine.
| Compound Name | 3-(2-amino-3-propylsulfanylpropyl)pyridin-4-amine |
|---|---|
| PubChem CID | 65129254 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-(2-amino-3-propylsulfanylpropyl)pyridin-4-amine |
| SMILES | CCCSCC(N)Cc1cnccc1N |
| InChI | InChI=1S/C11H19N3S/c1-2-5-15-8-10(12)6-9-7-14-4-3-11(9)13/h3-4,7,10H,2,5-6,8,12H2,1H3,(H2,13,14) |
| InChIKey | GQDPEXXBBAWCQH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|