C9H13ClN2 — CID 130480258
3-(2-chlorobutyl)pyridin-4-amine (PubChem CID 130480258) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 3-(2-chlorobutyl)pyridin-4-amine.
| Compound Name | 3-(2-chlorobutyl)pyridin-4-amine |
|---|---|
| PubChem CID | 130480258 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-(2-chlorobutyl)pyridin-4-amine |
| SMILES | CCC(Cl)Cc1cnccc1N |
| InChI | InChI=1S/C9H13ClN2/c1-2-8(10)5-7-6-12-4-3-9(7)11/h3-4,6,8H,2,5H2,1H3,(H2,11,12) |
| InChIKey | AFDPABFDJJVLJW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|