C10H14N2O2 — CID 79617121
1-(4-amino-3-pyridinyl)-3-methoxybutan-2-one (PubChem CID 79617121) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(4-amino-3-pyridinyl)-3-methoxybutan-2-one.
| Compound Name | 1-(4-amino-3-pyridinyl)-3-methoxybutan-2-one |
|---|---|
| PubChem CID | 79617121 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(4-amino-3-pyridinyl)-3-methoxybutan-2-one |
| SMILES | COC(C)C(=O)Cc1cnccc1N |
| InChI | InChI=1S/C10H14N2O2/c1-7(14-2)10(13)5-8-6-12-4-3-9(8)11/h3-4,6-7H,5H2,1-2H3,(H2,11,12) |
| InChIKey | QKTVRWKIROYWPS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |