C10H15F3N4 — CID 105249119
3-(5,5,5-trifluoro-2-hydrazinylpentyl)pyridin-4-amine (PubChem CID 105249119) has the molecular formula C10H15F3N4 and a molecular weight of 248.25 g/mol. Its IUPAC name is 3-(5,5,5-trifluoro-2-hydrazinylpentyl)pyridin-4-amine.
| Compound Name | 3-(5,5,5-trifluoro-2-hydrazinylpentyl)pyridin-4-amine |
|---|---|
| PubChem CID | 105249119 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(5,5,5-trifluoro-2-hydrazinylpentyl)pyridin-4-amine |
| SMILES | NNC(CCC(F)(F)F)Cc1cnccc1N |
| InChI | InChI=1S/C10H15F3N4/c11-10(12,13)3-1-8(17-15)5-7-6-16-4-2-9(7)14/h2,4,6,8,17H,1,3,5,15H2,(H2,14,16) |
| InChIKey | GGJUVMCNYGNGPQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|