C14H16F3N3 — CID 105248989
(5,5,5-trifluoro-1-quinolin-4-ylpentan-2-yl)hydrazine (PubChem CID 105248989) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is (5,5,5-trifluoro-1-quinolin-4-ylpentan-2-yl)hydrazine.
| Compound Name | (5,5,5-trifluoro-1-quinolin-4-ylpentan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105248989 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (5,5,5-trifluoro-1-quinolin-4-ylpentan-2-yl)hydrazine |
| SMILES | NNC(CCC(F)(F)F)Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C14H16F3N3/c15-14(16,17)7-5-11(20-18)9-10-6-8-19-13-4-2-1-3-12(10)13/h1-4,6,8,11,20H,5,7,9,18H2 |
| InChIKey | IZWCIEJMQMIFQY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|