C12H15F3N4 — CID 105313825
[1-(benzimidazol-1-yl)-5,5,5-trifluoropentan-2-yl]hydrazine (PubChem CID 105313825) has the molecular formula C12H15F3N4 and a molecular weight of 272.27 g/mol. Its IUPAC name is [1-(benzimidazol-1-yl)-5,5,5-trifluoropentan-2-yl]hydrazine.
| Compound Name | [1-(benzimidazol-1-yl)-5,5,5-trifluoropentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105313825 |
| Molecular Formula | C12H15F3N4 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [1-(benzimidazol-1-yl)-5,5,5-trifluoropentan-2-yl]hydrazine |
| SMILES | NNC(CCC(F)(F)F)Cn1cnc2ccccc21 |
| InChI | InChI=1S/C12H15F3N4/c13-12(14,15)6-5-9(18-16)7-19-8-17-10-3-1-2-4-11(10)19/h1-4,8-9,18H,5-7,16H2 |
| InChIKey | DTUFVBQGUCRWCW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|