C14H22N4O2S — CID 105310801
[1-(benzimidazol-1-yl)-5-ethylsulfonylpentan-2-yl]hydrazine (PubChem CID 105310801) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is [1-(benzimidazol-1-yl)-5-ethylsulfonylpentan-2-yl]hydrazine.
| Compound Name | [1-(benzimidazol-1-yl)-5-ethylsulfonylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105310801 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [1-(benzimidazol-1-yl)-5-ethylsulfonylpentan-2-yl]hydrazine |
| SMILES | CCS(=O)(=O)CCCC(Cn1cnc2ccccc21)NN |
| InChI | InChI=1S/C14H22N4O2S/c1-2-21(19,20)9-5-6-12(17-15)10-18-11-16-13-7-3-4-8-14(13)18/h3-4,7-8,11-12,17H,2,5-6,9-10,15H2,1H3 |
| InChIKey | NVKCULQKXYTNIX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|