C16H25N3O — CID 103031337
1-(benzimidazol-1-yl)-5-methoxy-N,5-dimethylhexan-2-amine (PubChem CID 103031337) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-(benzimidazol-1-yl)-5-methoxy-N,5-dimethylhexan-2-amine.
| Compound Name | 1-(benzimidazol-1-yl)-5-methoxy-N,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 103031337 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-(benzimidazol-1-yl)-5-methoxy-N,5-dimethylhexan-2-amine |
| SMILES | CNC(CCC(C)(C)OC)Cn1cnc2ccccc21 |
| InChI | InChI=1S/C16H25N3O/c1-16(2,20-4)10-9-13(17-3)11-19-12-18-14-7-5-6-8-15(14)19/h5-8,12-13,17H,9-11H2,1-4H3 |
| InChIKey | YFGXWZDXXLLJBA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |