C14H14F3NO2 — CID 103216898
1-quinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol (PubChem CID 103216898) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1-quinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol.
| Compound Name | 1-quinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 103216898 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-quinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)F)Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)9-20-8-11(19)7-10-5-6-18-13-4-2-1-3-12(10)13/h1-6,11,19H,7-9H2 |
| InChIKey | NHYOOKHWGUQBPZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |