C11H12ClF3O3 — CID 167743089
1-(2-chlorophenoxy)-3-(2,2,2-trifluoroethoxy)propan-2-ol (PubChem CID 167743089) has the molecular formula C11H12ClF3O3 and a molecular weight of 284.66 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)-3-(2,2,2-trifluoroethoxy)propan-2-ol.
| Compound Name | 1-(2-chlorophenoxy)-3-(2,2,2-trifluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 167743089 |
| Molecular Formula | C11H12ClF3O3 |
| Molecular Weight | 284.66 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1-(2-chlorophenoxy)-3-(2,2,2-trifluoroethoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)F)COc1ccccc1Cl |
| InChI | InChI=1S/C11H12ClF3O3/c12-9-3-1-2-4-10(9)18-6-8(16)5-17-7-11(13,14)15/h1-4,8,16H,5-7H2 |
| InChIKey | ZDIDQPLFPPOGGL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |