C15H17NO3 — CID 103547520
1-(1,3-dioxolan-2-yl)-3-quinolin-4-ylpropan-2-ol (PubChem CID 103547520) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-3-quinolin-4-ylpropan-2-ol.
| Compound Name | 1-(1,3-dioxolan-2-yl)-3-quinolin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 103547520 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-3-quinolin-4-ylpropan-2-ol |
| SMILES | OC(Cc1ccnc2ccccc12)CC1OCCO1 |
| InChI | InChI=1S/C15H17NO3/c17-12(10-15-18-7-8-19-15)9-11-5-6-16-14-4-2-1-3-13(11)14/h1-6,12,15,17H,7-10H2 |
| InChIKey | OLOGYLCLFKEZBS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |