C13H17F3N4 — CID 105248982
[5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-yl]hydrazine (PubChem CID 105248982) has the molecular formula C13H17F3N4 and a molecular weight of 286.30 g/mol. Its IUPAC name is [5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-yl]hydrazine.
| Compound Name | [5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105248982 |
| Molecular Formula | C13H17F3N4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-yl]hydrazine |
| SMILES | Cn1nc(CC(CCC(F)(F)F)NN)c2ccccc21 |
| InChI | InChI=1S/C13H17F3N4/c1-20-12-5-3-2-4-10(12)11(19-20)8-9(18-17)6-7-13(14,15)16/h2-5,9,18H,6-8,17H2,1H3 |
| InChIKey | GGJGYLSLBWCAQW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|