C13H15F3N2O — CID 79954762
5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-ol (PubChem CID 79954762) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-ol.
| Compound Name | 5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-ol |
|---|---|
| PubChem CID | 79954762 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5,5,5-trifluoro-1-(1-methylindazol-3-yl)pentan-2-ol |
| SMILES | Cn1nc(CC(O)CCC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C13H15F3N2O/c1-18-12-5-3-2-4-10(12)11(17-18)8-9(19)6-7-13(14,15)16/h2-5,9,19H,6-8H2,1H3 |
| InChIKey | OMFTVIAUGXBODA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |