About 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol
1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol (PubChem CID 86748513) has the molecular formula C9H16ClN3O
and a molecular weight of 217.70 g/mol. Its IUPAC name is 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol |
| PubChem CID | 86748513 |
| Molecular Formula | C9H16ClN3O |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol |
| SMILES | CCC(CC)C(O)C(Cl)c1ncn[nH]1 |
| InChI | InChI=1S/C9H16ClN3O/c1-3-6(4-2)8(14)7(10)9-11-5-12-13-9/h5-8,14H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | HPSRTWSIDFCUDQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol?
The IUPAC name of 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol (CID 86748513) is 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol.
What is the SMILES notation for 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol?
The canonical SMILES for 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol is CCC(CC)C(O)C(Cl)c1ncn[nH]1.
What is the InChIKey of 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol?
The InChIKey is HPSRTWSIDFCUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3O/c1-3-6(4-2)8(14)7(10)9-11-5-12-13-9/h5-8,14H,3-4H2,1-2H3,(H,11,12,13).
What are the key properties of 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol?
1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol has a molecular weight of 217.70 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-ethyl-1-(1H-1,2,4-triazol-5-yl)pentan-2-ol is sourced from PubChem (CID 86748513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).