C12H15N3O — CID 65363176
2-(4-ethylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol (PubChem CID 65363176) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol.
| Compound Name | 2-(4-ethylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
|---|---|
| PubChem CID | 65363176 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(4-ethylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
| SMILES | CCc1ccc(CC(O)c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H15N3O/c1-2-9-3-5-10(6-4-9)7-11(16)12-13-8-14-15-12/h3-6,8,11,16H,2,7H2,1H3,(H,13,14,15) |
| InChIKey | JFFNKPCIMWDZNC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |