C10H10IN3O — CID 65479320
2-(4-iodophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol (PubChem CID 65479320) has the molecular formula C10H10IN3O and a molecular weight of 315.11 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol.
| Compound Name | 2-(4-iodophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
|---|---|
| PubChem CID | 65479320 |
| Molecular Formula | C10H10IN3O |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-(4-iodophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
| SMILES | OC(Cc1ccc(I)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H10IN3O/c11-8-3-1-7(2-4-8)5-9(15)10-12-6-13-14-10/h1-4,6,9,15H,5H2,(H,12,13,14) |
| InChIKey | JDZMANDJWGPPOQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|