C10H9ClFN3O — CID 65363109
2-(2-chloro-6-fluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol (PubChem CID 65363109) has the molecular formula C10H9ClFN3O and a molecular weight of 241.65 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
|---|---|
| PubChem CID | 65363109 |
| Molecular Formula | C10H9ClFN3O |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
| SMILES | OC(Cc1c(F)cccc1Cl)c1ncn[nH]1 |
| InChI | InChI=1S/C10H9ClFN3O/c11-7-2-1-3-8(12)6(7)4-9(16)10-13-5-14-15-10/h1-3,5,9,16H,4H2,(H,13,14,15) |
| InChIKey | ZTIFKGMLYNTMBM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |