C10H9F2N3O — CID 82920324
2-(3,4-difluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol (PubChem CID 82920324) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol.
| Compound Name | 2-(3,4-difluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
|---|---|
| PubChem CID | 82920324 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(1H-1,2,4-triazol-5-yl)ethanol |
| SMILES | OC(Cc1ccc(F)c(F)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H9F2N3O/c11-7-2-1-6(3-8(7)12)4-9(16)10-13-5-14-15-10/h1-3,5,9,16H,4H2,(H,13,14,15) |
| InChIKey | SLPJHXNXPXSHDA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |