C6H11N3O3S — CID 65362596
3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-ol (PubChem CID 65362596) has the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. Its IUPAC name is 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-ol.
| Compound Name | 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 65362596 |
| Molecular Formula | C6H11N3O3S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-ol |
| SMILES | CS(=O)(=O)CCC(O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H11N3O3S/c1-13(11,12)3-2-5(10)6-7-4-8-9-6/h4-5,10H,2-3H2,1H3,(H,7,8,9) |
| InChIKey | JIXIDILWSOBNKO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |