C9H15N3O2 — CID 21360623
5-(5-methoxy-3,4-dimethyloxolan-2-yl)-1H-1,2,4-triazole (PubChem CID 21360623) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-(5-methoxy-3,4-dimethyloxolan-2-yl)-1H-1,2,4-triazole.
| Compound Name | 5-(5-methoxy-3,4-dimethyloxolan-2-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 21360623 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-(5-methoxy-3,4-dimethyloxolan-2-yl)-1H-1,2,4-triazole |
| SMILES | COC1OC(c2ncn[nH]2)C(C)C1C |
| InChI | InChI=1S/C9H15N3O2/c1-5-6(2)9(13-3)14-7(5)8-10-4-11-12-8/h4-7,9H,1-3H3,(H,10,11,12) |
| InChIKey | BVJJALPXXOYXBW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |