C16H18Cl2N6O2 — CID 57008011
1-(3,4-dichlorophenoxy)-3-methyl-3-(1H-1,2,4-triazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethyl)butan-2-ol (PubChem CID 57008011) has the molecular formula C16H18Cl2N6O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenoxy)-3-methyl-3-(1H-1,2,4-triazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethyl)butan-2-ol.
| Compound Name | 1-(3,4-dichlorophenoxy)-3-methyl-3-(1H-1,2,4-triazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethyl)butan-2-ol |
|---|---|
| PubChem CID | 57008011 |
| Molecular Formula | C16H18Cl2N6O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-(3,4-dichlorophenoxy)-3-methyl-3-(1H-1,2,4-triazol-5-yl)-2-(1H-1,2,4-triazol-5-ylmethyl)butan-2-ol |
| SMILES | CC(C)(c1ncn[nH]1)C(O)(COc1ccc(Cl)c(Cl)c1)Cc1ncn[nH]1 |
| InChI | InChI=1S/C16H18Cl2N6O2/c1-15(2,14-20-9-22-24-14)16(25,6-13-19-8-21-23-13)7-26-10-3-4-11(17)12(18)5-10/h3-5,8-9,25H,6-7H2,1-2H3,(H,19,21,23)(H,20,22,24) |
| InChIKey | GMSYZMTWZRKPFE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |