C11H11Cl2N3OS — CID 88654184
2-(2,4-dichlorophenyl)-1-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propan-2-ol (PubChem CID 88654184) has the molecular formula C11H11Cl2N3OS and a molecular weight of 304.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propan-2-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 88654184 |
| Molecular Formula | C11H11Cl2N3OS |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propan-2-ol |
| SMILES | OC(CS)(Cc1ncn[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N3OS/c12-7-1-2-8(9(13)3-7)11(17,5-18)4-10-14-6-15-16-10/h1-3,6,17-18H,4-5H2,(H,14,15,16) |
| InChIKey | MTTRHEUCKYEUAJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|