C12H17Cl3OSi — CID 19086773
1-chloro-2-(2,4-dichlorophenyl)-3-trimethylsilylpropan-2-ol (PubChem CID 19086773) has the molecular formula C12H17Cl3OSi and a molecular weight of 311.71 g/mol. Its IUPAC name is 1-chloro-2-(2,4-dichlorophenyl)-3-trimethylsilylpropan-2-ol.
| Compound Name | 1-chloro-2-(2,4-dichlorophenyl)-3-trimethylsilylpropan-2-ol |
|---|---|
| PubChem CID | 19086773 |
| Molecular Formula | C12H17Cl3OSi |
| Molecular Weight | 311.71 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1-chloro-2-(2,4-dichlorophenyl)-3-trimethylsilylpropan-2-ol |
| SMILES | C[Si](C)(C)CC(O)(CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl3OSi/c1-17(2,3)8-12(16,7-13)10-5-4-9(14)6-11(10)15/h4-6,16H,7-8H2,1-3H3 |
| InChIKey | KCFWMNNSRQCESK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|