C11H11Cl5O — CID 19763618
1,4,5-trichloro-2-(2,4-dichlorophenyl)pentan-2-ol (PubChem CID 19763618) has the molecular formula C11H11Cl5O and a molecular weight of 336.47 g/mol. Its IUPAC name is 1,4,5-trichloro-2-(2,4-dichlorophenyl)pentan-2-ol.
| Compound Name | 1,4,5-trichloro-2-(2,4-dichlorophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 19763618 |
| Molecular Formula | C11H11Cl5O |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 1,4,5-trichloro-2-(2,4-dichlorophenyl)pentan-2-ol |
| SMILES | OC(CCl)(CC(Cl)CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl5O/c12-5-8(15)4-11(17,6-13)9-2-1-7(14)3-10(9)16/h1-3,8,17H,4-6H2 |
| InChIKey | QJTGQCDJNRYXFU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|