C10H10Cl2O4 — CID 118141013
(2R,3R)-3-(2,4-dichlorophenyl)-2,3-dihydroxybutanoic acid (PubChem CID 118141013) has the molecular formula C10H10Cl2O4 and a molecular weight of 265.09 g/mol. Its IUPAC name is (2R,3R)-3-(2,4-dichlorophenyl)-2,3-dihydroxybutanoic acid.
| Compound Name | (2R,3R)-3-(2,4-dichlorophenyl)-2,3-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 118141013 |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (2R,3R)-3-(2,4-dichlorophenyl)-2,3-dihydroxybutanoic acid |
| SMILES | C[C@@](O)(c1ccc(Cl)cc1Cl)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H10Cl2O4/c1-10(16,8(13)9(14)15)6-3-2-5(11)4-7(6)12/h2-4,8,13,16H,1H3,(H,14,15)/t8-,10+/m0/s1 |
| InChIKey | ZUNNQSDLIDFNBL-WCBMZHEXSA-N |
| XLogP | 1.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |