About 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide
2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide (PubChem CID 110487685) has the molecular formula C12H15Cl2NO
and a molecular weight of 260.16 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide |
| PubChem CID | 110487685 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide |
| SMILES | CN(C)C(=O)C(C)(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c1-12(2,11(16)15(3)4)9-6-5-8(13)7-10(9)14/h5-7H,1-4H3 |
| InChIKey | MJZPBYVZSUNIOP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide?
The IUPAC name of 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide (CID 110487685) is 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide?
The canonical SMILES for 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide is CN(C)C(=O)C(C)(C)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide?
The InChIKey is MJZPBYVZSUNIOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO/c1-12(2,11(16)15(3)4)9-6-5-8(13)7-10(9)14/h5-7H,1-4H3.
What are the key properties of 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide?
2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide has a molecular weight of 260.16 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-N,N,2-trimethylpropanamide is sourced from PubChem (CID 110487685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).