C10H13Cl2O4P — CID 125471562
(1R)-1-(2,4-dichlorophenyl)-1-dimethoxyphosphorylethanol (PubChem CID 125471562) has the molecular formula C10H13Cl2O4P and a molecular weight of 299.09 g/mol. Its IUPAC name is (1R)-1-(2,4-dichlorophenyl)-1-dimethoxyphosphorylethanol.
| Compound Name | (1R)-1-(2,4-dichlorophenyl)-1-dimethoxyphosphorylethanol |
|---|---|
| PubChem CID | 125471562 |
| Molecular Formula | C10H13Cl2O4P |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | (1R)-1-(2,4-dichlorophenyl)-1-dimethoxyphosphorylethanol |
| SMILES | COP(=O)(OC)[C@@](C)(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2O4P/c1-10(13,17(14,15-2)16-3)8-5-4-7(11)6-9(8)12/h4-6,13H,1-3H3/t10-/m1/s1 |
| InChIKey | JOPWPYFFGFVYOU-SNVBAGLBSA-N |
| XLogP | 3.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|