C14H20Cl2O — CID 139474082
3-(2,4-dichlorophenyl)-2-methylheptan-3-ol (PubChem CID 139474082) has the molecular formula C14H20Cl2O and a molecular weight of 275.22 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-methylheptan-3-ol.
| Compound Name | 3-(2,4-dichlorophenyl)-2-methylheptan-3-ol |
|---|---|
| PubChem CID | 139474082 |
| Molecular Formula | C14H20Cl2O |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-methylheptan-3-ol |
| SMILES | CCCCC(O)(c1ccc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C14H20Cl2O/c1-4-5-8-14(17,10(2)3)12-7-6-11(15)9-13(12)16/h6-7,9-10,17H,4-5,8H2,1-3H3 |
| InChIKey | XRCWOKHWBGFNCU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |