C11H9Cl3O2 — CID 71338635
5-chloro-4-(2,4-dichlorophenyl)pent-2-yne-1,4-diol (PubChem CID 71338635) has the molecular formula C11H9Cl3O2 and a molecular weight of 279.55 g/mol. Its IUPAC name is 5-chloro-4-(2,4-dichlorophenyl)pent-2-yne-1,4-diol.
| Compound Name | 5-chloro-4-(2,4-dichlorophenyl)pent-2-yne-1,4-diol |
|---|---|
| PubChem CID | 71338635 |
| Molecular Formula | C11H9Cl3O2 |
| Molecular Weight | 279.55 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 5-chloro-4-(2,4-dichlorophenyl)pent-2-yne-1,4-diol |
| SMILES | OCC#CC(O)(CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl3O2/c12-7-11(16,4-1-5-15)9-3-2-8(13)6-10(9)14/h2-3,6,15-16H,5,7H2 |
| InChIKey | FNABAHZPVBTUGQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|