C11H8Cl2F2O2 — CID 126693466
4-(3,5-dichlorophenyl)-5,5-difluoropent-2-yne-1,4-diol (PubChem CID 126693466) has the molecular formula C11H8Cl2F2O2 and a molecular weight of 281.09 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-5,5-difluoropent-2-yne-1,4-diol.
| Compound Name | 4-(3,5-dichlorophenyl)-5,5-difluoropent-2-yne-1,4-diol |
|---|---|
| PubChem CID | 126693466 |
| Molecular Formula | C11H8Cl2F2O2 |
| Molecular Weight | 281.09 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-5,5-difluoropent-2-yne-1,4-diol |
| SMILES | OCC#CC(O)(c1cc(Cl)cc(Cl)c1)C(F)F |
| InChI | InChI=1S/C11H8Cl2F2O2/c12-8-4-7(5-9(13)6-8)11(17,10(14)15)2-1-3-16/h4-6,10,16-17H,3H2 |
| InChIKey | TWCVGVIQHAYYAA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|