C11H9Cl2F3O — CID 118988141
(2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoropent-4-en-2-ol (PubChem CID 118988141) has the molecular formula C11H9Cl2F3O and a molecular weight of 285.09 g/mol. Its IUPAC name is (2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoropent-4-en-2-ol.
| Compound Name | (2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoropent-4-en-2-ol |
|---|---|
| PubChem CID | 118988141 |
| Molecular Formula | C11H9Cl2F3O |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (2S)-2-(3,5-dichlorophenyl)-1,1,1-trifluoropent-4-en-2-ol |
| SMILES | C=CC[C@](O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C11H9Cl2F3O/c1-2-3-10(17,11(14,15)16)7-4-8(12)6-9(13)5-7/h2,4-6,17H,1,3H2/t10-/m0/s1 |
| InChIKey | GMFNEITXHYHTDD-JTQLQIEISA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|