C12H11ClF4O — CID 177496147
(Z,2R)-2-(3-chloro-5-fluorophenyl)-1,1,1-trifluorohex-4-en-2-ol (PubChem CID 177496147) has the molecular formula C12H11ClF4O and a molecular weight of 282.66 g/mol. Its IUPAC name is (Z,2R)-2-(3-chloro-5-fluorophenyl)-1,1,1-trifluorohex-4-en-2-ol.
| Compound Name | (Z,2R)-2-(3-chloro-5-fluorophenyl)-1,1,1-trifluorohex-4-en-2-ol |
|---|---|
| PubChem CID | 177496147 |
| Molecular Formula | C12H11ClF4O |
| Molecular Weight | 282.66 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | (Z,2R)-2-(3-chloro-5-fluorophenyl)-1,1,1-trifluorohex-4-en-2-ol |
| SMILES | C/C=C\C[C@@](O)(c1cc(F)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF4O/c1-2-3-4-11(18,12(15,16)17)8-5-9(13)7-10(14)6-8/h2-3,5-7,18H,4H2,1H3/b3-2-/t11-/m1/s1 |
| InChIKey | HXBMFPNRHJNGRX-OTDNITJGSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|