C10H8BrCl4FO — CID 21406975
1-bromo-4,4,4-trichloro-2-(3-chloro-5-fluorophenyl)butan-2-ol (PubChem CID 21406975) has the molecular formula C10H8BrCl4FO and a molecular weight of 384.89 g/mol. Its IUPAC name is 1-bromo-4,4,4-trichloro-2-(3-chloro-5-fluorophenyl)butan-2-ol.
| Compound Name | 1-bromo-4,4,4-trichloro-2-(3-chloro-5-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 21406975 |
| Molecular Formula | C10H8BrCl4FO |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 381.85 |
| IUPAC Name | 1-bromo-4,4,4-trichloro-2-(3-chloro-5-fluorophenyl)butan-2-ol |
| SMILES | OC(CBr)(CC(Cl)(Cl)Cl)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C10H8BrCl4FO/c11-5-9(17,4-10(13,14)15)6-1-7(12)3-8(16)2-6/h1-3,17H,4-5H2 |
| InChIKey | MXYORBZYNMUZLO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|