C11H10BrF3O — CID 121006575
2-(4-bromophenyl)-1,1,1-trifluoropent-4-en-2-ol (PubChem CID 121006575) has the molecular formula C11H10BrF3O and a molecular weight of 295.10 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,1,1-trifluoropent-4-en-2-ol.
| Compound Name | 2-(4-bromophenyl)-1,1,1-trifluoropent-4-en-2-ol |
|---|---|
| PubChem CID | 121006575 |
| Molecular Formula | C11H10BrF3O |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 2-(4-bromophenyl)-1,1,1-trifluoropent-4-en-2-ol |
| SMILES | C=CCC(O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H10BrF3O/c1-2-7-10(16,11(13,14)15)8-3-5-9(12)6-4-8/h2-6,16H,1,7H2 |
| InChIKey | YULUGZZXANDBLN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|