C13H15Br — CID 138969388
1-bromo-4-[(3S)-3-methylhexa-1,5-dien-3-yl]benzene (PubChem CID 138969388) has the molecular formula C13H15Br and a molecular weight of 251.17 g/mol. Its IUPAC name is 1-bromo-4-[(3S)-3-methylhexa-1,5-dien-3-yl]benzene.
| Compound Name | 1-bromo-4-[(3S)-3-methylhexa-1,5-dien-3-yl]benzene |
|---|---|
| PubChem CID | 138969388 |
| Molecular Formula | C13H15Br |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 1-bromo-4-[(3S)-3-methylhexa-1,5-dien-3-yl]benzene |
| SMILES | C=CC[C@@](C)(C=C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H15Br/c1-4-10-13(3,5-2)11-6-8-12(14)9-7-11/h4-9H,1-2,10H2,3H3/t13-/m1/s1 |
| InChIKey | BMFQQUPYUIVQOD-CYBMUJFWSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|