C9H8BrF3O2Os — CID 160846358
2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol;osmium (PubChem CID 160846358) has the molecular formula C9H8BrF3O2Os and a molecular weight of 475.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol;osmium.
| Compound Name | 2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol;osmium |
|---|---|
| PubChem CID | 160846358 |
| Molecular Formula | C9H8BrF3O2Os |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 475.93 |
| IUPAC Name | 2-(4-bromophenyl)-3,3,3-trifluoropropane-1,2-diol;osmium |
| SMILES | OCC(O)(c1ccc(Br)cc1)C(F)(F)F.[Os] |
| InChI | InChI=1S/C9H8BrF3O2.Os/c10-7-3-1-6(2-4-7)8(15,5-14)9(11,12)13;/h1-4,14-15H,5H2; |
| InChIKey | SIRQQAUZPDSYTQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |