C26H17Br2F3O3 — CID 10438461
1,1-bis[4-(4-bromophenoxy)phenyl]-2,2,2-trifluoroethanol (PubChem CID 10438461) has the molecular formula C26H17Br2F3O3 and a molecular weight of 594.22 g/mol. Its IUPAC name is 1,1-bis[4-(4-bromophenoxy)phenyl]-2,2,2-trifluoroethanol.
| Compound Name | 1,1-bis[4-(4-bromophenoxy)phenyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 10438461 |
| Molecular Formula | C26H17Br2F3O3 |
| Molecular Weight | 594.22 g/mol |
| Exact Mass | 591.95 |
| IUPAC Name | 1,1-bis[4-(4-bromophenoxy)phenyl]-2,2,2-trifluoroethanol |
| SMILES | OC(c1ccc(Oc2ccc(Br)cc2)cc1)(c1ccc(Oc2ccc(Br)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H17Br2F3O3/c27-19-5-13-23(14-6-19)33-21-9-1-17(2-10-21)25(32,26(29,30)31)18-3-11-22(12-4-18)34-24-15-7-20(28)8-16-24/h1-16,32H |
| InChIKey | LTVRFHCXHMJKBM-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.22 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |