C8H5BrF3IO — CID 68607834
(1S)-1-(4-bromophenyl)-2,2,2-trifluoro-1-iodoethanol (PubChem CID 68607834) has the molecular formula C8H5BrF3IO and a molecular weight of 380.93 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-2,2,2-trifluoro-1-iodoethanol.
| Compound Name | (1S)-1-(4-bromophenyl)-2,2,2-trifluoro-1-iodoethanol |
|---|---|
| PubChem CID | 68607834 |
| Molecular Formula | C8H5BrF3IO |
| Molecular Weight | 380.93 g/mol |
| Exact Mass | 379.85 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-2,2,2-trifluoro-1-iodoethanol |
| SMILES | O[C@](I)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H5BrF3IO/c9-6-3-1-5(2-4-6)7(13,14)8(10,11)12/h1-4,14H/t7-/m1/s1 |
| InChIKey | MWQZADZFNIQTGH-SSDOTTSWSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|