C14H15Cl2F3O2Si — CID 71142862
2-(3,5-dichlorophenyl)-1,1,1-trifluoro-5-trimethylsilyloxypent-3-yn-2-ol (PubChem CID 71142862) has the molecular formula C14H15Cl2F3O2Si and a molecular weight of 371.26 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-1,1,1-trifluoro-5-trimethylsilyloxypent-3-yn-2-ol.
| Compound Name | 2-(3,5-dichlorophenyl)-1,1,1-trifluoro-5-trimethylsilyloxypent-3-yn-2-ol |
|---|---|
| PubChem CID | 71142862 |
| Molecular Formula | C14H15Cl2F3O2Si |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-1,1,1-trifluoro-5-trimethylsilyloxypent-3-yn-2-ol |
| SMILES | C[Si](C)(C)OCC#CC(O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C14H15Cl2F3O2Si/c1-22(2,3)21-6-4-5-13(20,14(17,18)19)10-7-11(15)9-12(16)8-10/h7-9,20H,6H2,1-3H3 |
| InChIKey | TVEACLWZTVANFN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|