C10H8F3N3 — CID 174633891
5-[4-methyl-2-(trifluoromethyl)phenyl]-1H-1,2,4-triazole (PubChem CID 174633891) has the molecular formula C10H8F3N3 and a molecular weight of 227.19 g/mol. Its IUPAC name is 5-[4-methyl-2-(trifluoromethyl)phenyl]-1H-1,2,4-triazole.
| Compound Name | 5-[4-methyl-2-(trifluoromethyl)phenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 174633891 |
| Molecular Formula | C10H8F3N3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-[4-methyl-2-(trifluoromethyl)phenyl]-1H-1,2,4-triazole |
| SMILES | Cc1ccc(-c2ncn[nH]2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3N3/c1-6-2-3-7(9-14-5-15-16-9)8(4-6)10(11,12)13/h2-5H,1H3,(H,14,15,16) |
| InChIKey | MGGZKYAHWPTIJU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |