C18H13F6IN3O2- — CID 175917746
CID 175917746 (PubChem CID 175917746) has the molecular formula C18H13F6IN3O2- and a molecular weight of 544.21 g/mol.
| Compound Name | CID 175917746 |
|---|---|
| PubChem CID | 175917746 |
| Molecular Formula | C18H13F6IN3O2- |
| Molecular Weight | 544.21 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | — |
| SMILES | CC1=C(/C=C\C(=O)O)[I-]C=C1.FC(F)(F)c1cc(-c2ncn[nH]2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6N3.C8H8IO2/c11-9(12,13)6-1-5(8-17-4-18-19-8)2-7(3-6)10(14,15)16;1-6-4-5-9-7(6)2-3-8(10)11/h1-4H,(H,17,18,19);2-5H,1H3,(H,10,11)/q;-1/b;3-2- |
| InChIKey | PKQARIJCZYNXNE-AHNKWOMYSA-N |
| XLogP | 2.03 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|